C22H22F3NO3 — CID 87621144
(2E,4E)-5-[6-(4-methoxybutan-2-yl)-3-pyridinyl]-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid (PubChem CID 87621144) has the molecular formula C22H22F3NO3 and a molecular weight of 405.42 g/mol. Its IUPAC name is (2E,4E)-5-[6-(4-methoxybutan-2-yl)-3-pyridinyl]-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-[6-(4-methoxybutan-2-yl)-3-pyridinyl]-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 87621144 |
| Molecular Formula | C22H22F3NO3 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | (2E,4E)-5-[6-(4-methoxybutan-2-yl)-3-pyridinyl]-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoic acid |
| SMILES | COCCC(C)c1ccc(/C(=C/C=C/C(=O)O)c2ccc(C(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C22H22F3NO3/c1-15(12-13-29-2)20-11-8-17(14-26-20)19(4-3-5-21(27)28)16-6-9-18(10-7-16)22(23,24)25/h3-11,14-15H,12-13H2,1-2H3,(H,27,28)/b5-3+,19-4+ |
| InChIKey | ATSSAVRJBHHKQW-IHKVXXGKSA-N |
| XLogP | 5.31 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|