C28H33N3O5 — CID 87622721
[4-(3,4-dimethoxyphenyl)-4a,5,8,8a-tetrahydro-1H-phthalazin-2-yl]-[4-[(4-oxidomorpholin-4-ium-4-yl)methyl]phenyl]methanone (PubChem CID 87622721) has the molecular formula C28H33N3O5 and a molecular weight of 491.59 g/mol. Its IUPAC name is [4-(3,4-dimethoxyphenyl)-4a,5,8,8a-tetrahydro-1H-phthalazin-2-yl]-[4-[(4-oxidomorpholin-4-ium-4-yl)methyl]phenyl]methanone.
| Compound Name | [4-(3,4-dimethoxyphenyl)-4a,5,8,8a-tetrahydro-1H-phthalazin-2-yl]-[4-[(4-oxidomorpholin-4-ium-4-yl)methyl]phenyl]methanone |
|---|---|
| PubChem CID | 87622721 |
| Molecular Formula | C28H33N3O5 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | [4-(3,4-dimethoxyphenyl)-4a,5,8,8a-tetrahydro-1H-phthalazin-2-yl]-[4-[(4-oxidomorpholin-4-ium-4-yl)methyl]phenyl]methanone |
| SMILES | COc1ccc(C2=NN(C(=O)c3ccc(C[N+]4([O-])CCOCC4)cc3)CC3CC=CCC23)cc1OC |
| InChI | InChI=1S/C28H33N3O5/c1-34-25-12-11-22(17-26(25)35-2)27-24-6-4-3-5-23(24)18-30(29-27)28(32)21-9-7-20(8-10-21)19-31(33)13-15-36-16-14-31/h3-4,7-12,17,23-24H,5-6,13-16,18-19H2,1-2H3 |
| InChIKey | GYNRVJQCBLORGU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|