C10H4F18S2 — CID 87624063
1,1,1,4,4,4-hexafluoro-2-[[1,1,1,4,4,4-hexafluoro-2-(trifluoromethyl)butan-2-yl]disulfanyl]-2-(trifluoromethyl)butane (PubChem CID 87624063) has the molecular formula C10H4F18S2 and a molecular weight of 530.24 g/mol. Its IUPAC name is 1,1,1,4,4,4-hexafluoro-2-[[1,1,1,4,4,4-hexafluoro-2-(trifluoromethyl)butan-2-yl]disulfanyl]-2-(trifluoromethyl)butane.
| Compound Name | 1,1,1,4,4,4-hexafluoro-2-[[1,1,1,4,4,4-hexafluoro-2-(trifluoromethyl)butan-2-yl]disulfanyl]-2-(trifluoromethyl)butane |
|---|---|
| PubChem CID | 87624063 |
| Molecular Formula | C10H4F18S2 |
| Molecular Weight | 530.24 g/mol |
| Exact Mass | 529.95 |
| IUPAC Name | 1,1,1,4,4,4-hexafluoro-2-[[1,1,1,4,4,4-hexafluoro-2-(trifluoromethyl)butan-2-yl]disulfanyl]-2-(trifluoromethyl)butane |
| SMILES | FC(F)(F)CC(SSC(CC(F)(F)F)(C(F)(F)F)C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H4F18S2/c11-5(12,13)1-3(7(17,18)19,8(20,21)22)29-30-4(9(23,24)25,10(26,27)28)2-6(14,15)16/h1-2H2 |
| InChIKey | DJZZAFWIBHQOBK-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.24 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|