C17H33N3O3 — CID 87660238
(E,4S)-4-[[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]amino]-N-methoxy-N,2,5-trimethylhex-2-enamide (PubChem CID 87660238) has the molecular formula C17H33N3O3 and a molecular weight of 327.47 g/mol. Its IUPAC name is (E,4S)-4-[[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]amino]-N-methoxy-N,2,5-trimethylhex-2-enamide.
| Compound Name | (E,4S)-4-[[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]amino]-N-methoxy-N,2,5-trimethylhex-2-enamide |
|---|---|
| PubChem CID | 87660238 |
| Molecular Formula | C17H33N3O3 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.25 |
| IUPAC Name | (E,4S)-4-[[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]amino]-N-methoxy-N,2,5-trimethylhex-2-enamide |
| SMILES | CNC(=O)[C@@H](N[C@H](/C=C(\C)C(=O)N(C)OC)C(C)C)C(C)(C)C |
| InChI | InChI=1S/C17H33N3O3/c1-11(2)13(10-12(3)16(22)20(8)23-9)19-14(15(21)18-7)17(4,5)6/h10-11,13-14,19H,1-9H3,(H,18,21)/b12-10+/t13-,14-/m1/s1 |
| InChIKey | WWYYSGMIZNWASJ-XMNZZIDVSA-N |
| XLogP | 1.73 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|