C11H18N2O3 — CID 87665948
[(1S)-1-cyano-7-oxononyl] N,N-ditritiocarbamate (PubChem CID 87665948) has the molecular formula C11H18N2O3 and a molecular weight of 230.29 g/mol. Its IUPAC name is [(1S)-1-cyano-7-oxononyl] N,N-ditritiocarbamate.
| Compound Name | [(1S)-1-cyano-7-oxononyl] N,N-ditritiocarbamate |
|---|---|
| PubChem CID | 87665948 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | [(1S)-1-cyano-7-oxononyl] N,N-ditritiocarbamate |
| SMILES | [3H]N([3H])C(=O)O[C@H](C#N)CCCCCC(=O)CC |
| InChI | InChI=1S/C11H18N2O3/c1-2-9(14)6-4-3-5-7-10(8-12)16-11(13)15/h10H,2-7H2,1H3,(H2,13,15)/t10-/m0/s1/i/hT2 |
| InChIKey | YROILLVRHKKUAA-PNYIOZHRSA-N |
| XLogP | 1.90 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|