C43H82NO3P — CID 87691283
ethyl-[(Z)-2-hydroxy-2-[(Z)-octadec-9-enoyl]-3-oxo-1-(trimethylazaniumyl)icos-11-enyl]phosphanide (PubChem CID 87691283) has the molecular formula C43H82NO3P and a molecular weight of 692.11 g/mol. Its IUPAC name is ethyl-[(Z)-2-hydroxy-2-[(Z)-octadec-9-enoyl]-3-oxo-1-(trimethylazaniumyl)icos-11-enyl]phosphanide.
| Compound Name | ethyl-[(Z)-2-hydroxy-2-[(Z)-octadec-9-enoyl]-3-oxo-1-(trimethylazaniumyl)icos-11-enyl]phosphanide |
|---|---|
| PubChem CID | 87691283 |
| Molecular Formula | C43H82NO3P |
| Molecular Weight | 692.11 g/mol |
| Exact Mass | 691.60 |
| IUPAC Name | ethyl-[(Z)-2-hydroxy-2-[(Z)-octadec-9-enoyl]-3-oxo-1-(trimethylazaniumyl)icos-11-enyl]phosphanide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)C(O)(C(=O)CCCCCCC/C=C\CCCCCCCC)C([P-]CC)[N+](C)(C)C |
| InChI | InChI=1S/C43H82NO3P/c1-7-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-40(45)43(47,42(48-9-3)44(4,5)6)41(46)39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-8-2/h22-25,42,47H,7-21,26-39H2,1-6H3/b24-22-,25-23- |
| InChIKey | QDDDGWSJQALQAF-HKOLQMFGSA-N |
| XLogP | 12.93 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.11 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|