C4H9N5O2 — CID 87704037
(3Z)-2-amino-3-(diaminomethylidenehydrazinylidene)propanoic acid (PubChem CID 87704037) has the molecular formula C4H9N5O2 and a molecular weight of 159.15 g/mol. Its IUPAC name is (3Z)-2-amino-3-(diaminomethylidenehydrazinylidene)propanoic acid.
| Compound Name | (3Z)-2-amino-3-(diaminomethylidenehydrazinylidene)propanoic acid |
|---|---|
| PubChem CID | 87704037 |
| Molecular Formula | C4H9N5O2 |
| Molecular Weight | 159.15 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | (3Z)-2-amino-3-(diaminomethylidenehydrazinylidene)propanoic acid |
| SMILES | NC(N)=N/N=C\C(N)C(=O)O |
| InChI | InChI=1S/C4H9N5O2/c5-2(3(10)11)1-8-9-4(6)7/h1-2H,5H2,(H,10,11)(H4,6,7,9)/b8-1- |
| InChIKey | QWBNBCJNELEVSW-QPIMQUGISA-N |
| XLogP | -2.34 |
| TPSA | 140.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.15 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|