C16H35O2PS2 — CID 87747653
bis(2,4,4-trimethylpentan-2-ylsulfanyl)phosphinic acid (PubChem CID 87747653) has the molecular formula C16H35O2PS2 and a molecular weight of 354.56 g/mol. Its IUPAC name is bis(2,4,4-trimethylpentan-2-ylsulfanyl)phosphinic acid.
| Compound Name | bis(2,4,4-trimethylpentan-2-ylsulfanyl)phosphinic acid |
|---|---|
| PubChem CID | 87747653 |
| Molecular Formula | C16H35O2PS2 |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | bis(2,4,4-trimethylpentan-2-ylsulfanyl)phosphinic acid |
| SMILES | CC(C)(C)CC(C)(C)SP(=O)(O)SC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C16H35O2PS2/c1-13(2,3)11-15(7,8)20-19(17,18)21-16(9,10)12-14(4,5)6/h11-12H2,1-10H3,(H,17,18) |
| InChIKey | KXOJGEMLBLCVAF-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|