C5H6F4N2O3S — CID 87777028
1H-imidazol-1-ium;1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 87777028) has the molecular formula C5H6F4N2O3S and a molecular weight of 250.17 g/mol. Its IUPAC name is 1H-imidazol-1-ium;1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | 1H-imidazol-1-ium;1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 87777028 |
| Molecular Formula | C5H6F4N2O3S |
| Molecular Weight | 250.17 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 1H-imidazol-1-ium;1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | C1=C[NH2+]C=N1.O=S(=O)([O-])C(F)(F)C(F)F |
| InChI | InChI=1S/C3H4N2.C2H2F4O3S/c1-2-5-3-4-1;3-1(4)2(5,6)10(7,8)9/h1-3H,(H,4,5);1H,(H,7,8,9) |
| InChIKey | LOZOAPSBGHOALW-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 86.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.17 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|