C9H14Cl3NO4 — CID 87778110
(3R)-3-(2,2,2-trichloroacetyl)oxy-4-(trimethylazaniumyl)butanoate (PubChem CID 87778110) has the molecular formula C9H14Cl3NO4 and a molecular weight of 306.57 g/mol. Its IUPAC name is (3R)-3-(2,2,2-trichloroacetyl)oxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | (3R)-3-(2,2,2-trichloroacetyl)oxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 87778110 |
| Molecular Formula | C9H14Cl3NO4 |
| Molecular Weight | 306.57 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | (3R)-3-(2,2,2-trichloroacetyl)oxy-4-(trimethylazaniumyl)butanoate |
| SMILES | C[N+](C)(C)C[C@@H](CC(=O)[O-])OC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H14Cl3NO4/c1-13(2,3)5-6(4-7(14)15)17-8(16)9(10,11)12/h6H,4-5H2,1-3H3/t6-/m1/s1 |
| InChIKey | MUXKDGQFSLPPKJ-ZCFIWIBFSA-N |
| XLogP | 0.11 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.57 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|