C16H12Br2O2 — CID 87794711
3,4-dibromo-2-hydroxy-1,2-diphenylbut-3-en-1-one (PubChem CID 87794711) has the molecular formula C16H12Br2O2 and a molecular weight of 396.08 g/mol. Its IUPAC name is 3,4-dibromo-2-hydroxy-1,2-diphenylbut-3-en-1-one.
| Compound Name | 3,4-dibromo-2-hydroxy-1,2-diphenylbut-3-en-1-one |
|---|---|
| PubChem CID | 87794711 |
| Molecular Formula | C16H12Br2O2 |
| Molecular Weight | 396.08 g/mol |
| Exact Mass | 393.92 |
| IUPAC Name | 3,4-dibromo-2-hydroxy-1,2-diphenylbut-3-en-1-one |
| SMILES | O=C(c1ccccc1)C(O)(C(Br)=CBr)c1ccccc1 |
| InChI | InChI=1S/C16H12Br2O2/c17-11-14(18)16(20,13-9-5-2-6-10-13)15(19)12-7-3-1-4-8-12/h1-11,20H |
| InChIKey | SCIVNZGDWXXJJR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.08 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |