C18H16N2O5S — CID 87799058
acenaphthylene-1,2-dione;1,6-diaminocyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 87799058) has the molecular formula C18H16N2O5S and a molecular weight of 372.40 g/mol. Its IUPAC name is acenaphthylene-1,2-dione;1,6-diaminocyclohexa-2,4-diene-1-sulfonic acid.
| Compound Name | acenaphthylene-1,2-dione;1,6-diaminocyclohexa-2,4-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 87799058 |
| Molecular Formula | C18H16N2O5S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | acenaphthylene-1,2-dione;1,6-diaminocyclohexa-2,4-diene-1-sulfonic acid |
| SMILES | NC1C=CC=CC1(N)S(=O)(=O)O.O=C1C(=O)c2cccc3cccc1c23 |
| InChI | InChI=1S/C12H6O2.C6H10N2O3S/c13-11-8-5-1-3-7-4-2-6-9(10(7)8)12(11)14;7-5-3-1-2-4-6(5,8)12(9,10)11/h1-6H;1-5H,7-8H2,(H,9,10,11) |
| InChIKey | DEPQMSLGJSQDLY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 140.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|