C39H51N5O7S — CID 87829199
4-[4-[[3-[[2-[(2-amino-5-sulfanylpentanoyl)amino]-3-phenylpropanoyl]amino]-1,2-benzoxazol-6-yl]oxy]butoxy]-3-methoxy-N,N-di(propan-2-yl)benzamide (PubChem CID 87829199) has the molecular formula C39H51N5O7S and a molecular weight of 733.93 g/mol. Its IUPAC name is 4-[4-[[3-[[2-[(2-amino-5-sulfanylpentanoyl)amino]-3-phenylpropanoyl]amino]-1,2-benzoxazol-6-yl]oxy]butoxy]-3-methoxy-N,N-di(propan-2-yl)benzamide.
| Compound Name | 4-[4-[[3-[[2-[(2-amino-5-sulfanylpentanoyl)amino]-3-phenylpropanoyl]amino]-1,2-benzoxazol-6-yl]oxy]butoxy]-3-methoxy-N,N-di(propan-2-yl)benzamide |
|---|---|
| PubChem CID | 87829199 |
| Molecular Formula | C39H51N5O7S |
| Molecular Weight | 733.93 g/mol |
| Exact Mass | 733.35 |
| IUPAC Name | 4-[4-[[3-[[2-[(2-amino-5-sulfanylpentanoyl)amino]-3-phenylpropanoyl]amino]-1,2-benzoxazol-6-yl]oxy]butoxy]-3-methoxy-N,N-di(propan-2-yl)benzamide |
| SMILES | COc1cc(C(=O)N(C(C)C)C(C)C)ccc1OCCCCOc1ccc2c(NC(=O)C(Cc3ccccc3)NC(=O)C(N)CCCS)noc2c1 |
| InChI | InChI=1S/C39H51N5O7S/c1-25(2)44(26(3)4)39(47)28-15-18-33(35(23-28)48-5)50-20-10-9-19-49-29-16-17-30-34(24-29)51-43-36(30)42-38(46)32(22-27-12-7-6-8-13-27)41-37(45)31(40)14-11-21-52/h6-8,12-13,15-18,23-26,31-32,52H,9-11,14,19-22,40H2,1-5H3,(H,41,45)(H,42,43,46) |
| InChIKey | HHIWODUNIKWKKB-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 158.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.93 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|