C33H44N4O10 — CID 91244031
tert-butyl [2-[[6-[4-[4-[di(propan-2-yl)carbamoyl]-2-methoxyphenoxy]butoxy]-1,2-benzoxazol-3-yl]amino]-2-oxoethyl]carbamoyl carbonate (PubChem CID 91244031) has the molecular formula C33H44N4O10 and a molecular weight of 656.73 g/mol. Its IUPAC name is tert-butyl [2-[[6-[4-[4-[di(propan-2-yl)carbamoyl]-2-methoxyphenoxy]butoxy]-1,2-benzoxazol-3-yl]amino]-2-oxoethyl]carbamoyl carbonate.
| Compound Name | tert-butyl [2-[[6-[4-[4-[di(propan-2-yl)carbamoyl]-2-methoxyphenoxy]butoxy]-1,2-benzoxazol-3-yl]amino]-2-oxoethyl]carbamoyl carbonate |
|---|---|
| PubChem CID | 91244031 |
| Molecular Formula | C33H44N4O10 |
| Molecular Weight | 656.73 g/mol |
| Exact Mass | 656.31 |
| IUPAC Name | tert-butyl [2-[[6-[4-[4-[di(propan-2-yl)carbamoyl]-2-methoxyphenoxy]butoxy]-1,2-benzoxazol-3-yl]amino]-2-oxoethyl]carbamoyl carbonate |
| SMILES | COc1cc(C(=O)N(C(C)C)C(C)C)ccc1OCCCCOc1ccc2c(NC(=O)CNC(=O)OC(=O)OC(C)(C)C)noc2c1 |
| InChI | InChI=1S/C33H44N4O10/c1-20(2)37(21(3)4)30(39)22-11-14-25(27(17-22)42-8)44-16-10-9-15-43-23-12-13-24-26(18-23)47-36-29(24)35-28(38)19-34-31(40)45-32(41)46-33(5,6)7/h11-14,17-18,20-21H,9-10,15-16,19H2,1-8H3,(H,34,40)(H,35,36,38) |
| InChIKey | HQBUTFHDKHVWQB-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 167.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.73 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|