C35H51N5O7S — CID 87829710
4-[4-[[3-[[2-[(2-amino-5-sulfanylpentanoyl)amino]-3-methylbutanoyl]amino]-1,2-benzoxazol-6-yl]oxy]butoxy]-3-methoxy-N,N-di(propan-2-yl)benzamide (PubChem CID 87829710) has the molecular formula C35H51N5O7S and a molecular weight of 685.89 g/mol. Its IUPAC name is 4-[4-[[3-[[2-[(2-amino-5-sulfanylpentanoyl)amino]-3-methylbutanoyl]amino]-1,2-benzoxazol-6-yl]oxy]butoxy]-3-methoxy-N,N-di(propan-2-yl)benzamide.
| Compound Name | 4-[4-[[3-[[2-[(2-amino-5-sulfanylpentanoyl)amino]-3-methylbutanoyl]amino]-1,2-benzoxazol-6-yl]oxy]butoxy]-3-methoxy-N,N-di(propan-2-yl)benzamide |
|---|---|
| PubChem CID | 87829710 |
| Molecular Formula | C35H51N5O7S |
| Molecular Weight | 685.89 g/mol |
| Exact Mass | 685.35 |
| IUPAC Name | 4-[4-[[3-[[2-[(2-amino-5-sulfanylpentanoyl)amino]-3-methylbutanoyl]amino]-1,2-benzoxazol-6-yl]oxy]butoxy]-3-methoxy-N,N-di(propan-2-yl)benzamide |
| SMILES | COc1cc(C(=O)N(C(C)C)C(C)C)ccc1OCCCCOc1ccc2c(NC(=O)C(NC(=O)C(N)CCCS)C(C)C)noc2c1 |
| InChI | InChI=1S/C35H51N5O7S/c1-21(2)31(37-33(41)27(36)11-10-18-48)34(42)38-32-26-14-13-25(20-29(26)47-39-32)45-16-8-9-17-46-28-15-12-24(19-30(28)44-7)35(43)40(22(3)4)23(5)6/h12-15,19-23,27,31,48H,8-11,16-18,36H2,1-7H3,(H,37,41)(H,38,39,42) |
| InChIKey | GVFWVTTUDGZQQD-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 158.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.89 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|