C14H16N4O10 — CID 87837522
2-hydroperoxy-2-[2-oxo-2-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)oxyethyl]butanedioic acid (PubChem CID 87837522) has the molecular formula C14H16N4O10 and a molecular weight of 400.30 g/mol. Its IUPAC name is 2-hydroperoxy-2-[2-oxo-2-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)oxyethyl]butanedioic acid.
| Compound Name | 2-hydroperoxy-2-[2-oxo-2-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)oxyethyl]butanedioic acid |
|---|---|
| PubChem CID | 87837522 |
| Molecular Formula | C14H16N4O10 |
| Molecular Weight | 400.30 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 2-hydroperoxy-2-[2-oxo-2-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)oxyethyl]butanedioic acid |
| SMILES | Cn1c(=O)c2c(nc(OC(=O)CC(CC(=O)O)(OO)C(=O)O)n2C)n(C)c1=O |
| InChI | InChI=1S/C14H16N4O10/c1-16-8-9(17(2)13(25)18(3)10(8)22)15-12(16)27-7(21)5-14(28-26,11(23)24)4-6(19)20/h26H,4-5H2,1-3H3,(H,19,20)(H,23,24) |
| InChIKey | HGFHWOPGMSFMSX-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 192.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.30 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|