C29H33N5O11S2 — CID 87879168
[(2R,3R,4S)-2-(6-benzamido-6,7-dihydropurin-1-yl)-5,5-bis(methylsulfonyloxymethyl)-4-phenylmethoxyoxolan-3-yl] acetate (PubChem CID 87879168) has the molecular formula C29H33N5O11S2 and a molecular weight of 691.74 g/mol. Its IUPAC name is [(2R,3R,4S)-2-(6-benzamido-6,7-dihydropurin-1-yl)-5,5-bis(methylsulfonyloxymethyl)-4-phenylmethoxyoxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4S)-2-(6-benzamido-6,7-dihydropurin-1-yl)-5,5-bis(methylsulfonyloxymethyl)-4-phenylmethoxyoxolan-3-yl] acetate |
|---|---|
| PubChem CID | 87879168 |
| Molecular Formula | C29H33N5O11S2 |
| Molecular Weight | 691.74 g/mol |
| Exact Mass | 691.16 |
| IUPAC Name | [(2R,3R,4S)-2-(6-benzamido-6,7-dihydropurin-1-yl)-5,5-bis(methylsulfonyloxymethyl)-4-phenylmethoxyoxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](N2C=Nc3nc[nH]c3C2NC(=O)c2ccccc2)OC(COS(C)(=O)=O)(COS(C)(=O)=O)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C29H33N5O11S2/c1-19(35)44-23-24(41-14-20-10-6-4-7-11-20)29(15-42-46(2,37)38,16-43-47(3,39)40)45-28(23)34-18-32-25-22(30-17-31-25)26(34)33-27(36)21-12-8-5-9-13-21/h4-13,17-18,23-24,26,28H,14-16H2,1-3H3,(H,30,31)(H,33,36)/t23-,24+,26?,28-/m1/s1 |
| InChIKey | NOAZSNIPGXPPFE-LOTHTAAMSA-N |
| XLogP | 1.38 |
| TPSA | 204.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.74 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|