About potassium 3-chloro-3-oxopropanoate
potassium 3-chloro-3-oxopropanoate (PubChem CID 87888612) has the molecular formula C3H2ClKO3
and a molecular weight of 160.60 g/mol. Its IUPAC name is potassium 3-chloro-3-oxopropanoate.
Molecular Properties
| Compound Name | potassium 3-chloro-3-oxopropanoate |
| PubChem CID | 87888612 |
| Molecular Formula | C3H2ClKO3 |
| Molecular Weight | 160.60 g/mol |
| Exact Mass | 159.93 |
| IUPAC Name | potassium 3-chloro-3-oxopropanoate |
| SMILES | O=C([O-])CC(=O)Cl.[K+] |
| InChI | InChI=1S/C3H3ClO3.K/c4-2(5)1-3(6)7;/h1H2,(H,6,7);/q;+1/p-1 |
| InChIKey | DMEXWUWPMCFFMA-UHFFFAOYSA-M |
| XLogP | -4.10 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.60 |
| LogP ≤ 5 | -4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze potassium 3-chloro-3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 3-chloro-3-oxopropanoate?
The IUPAC name of potassium 3-chloro-3-oxopropanoate (CID 87888612) is potassium 3-chloro-3-oxopropanoate.
What is the SMILES notation for potassium 3-chloro-3-oxopropanoate?
The canonical SMILES for potassium 3-chloro-3-oxopropanoate is O=C([O-])CC(=O)Cl.[K+].
What is the InChIKey of potassium 3-chloro-3-oxopropanoate?
The InChIKey is DMEXWUWPMCFFMA-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H3ClO3.K/c4-2(5)1-3(6)7;/h1H2,(H,6,7);/q;+1/p-1.
What are the key properties of potassium 3-chloro-3-oxopropanoate?
potassium 3-chloro-3-oxopropanoate has a molecular weight of 160.60 g/mol, XLogP of -4.10, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 3-chloro-3-oxopropanoate is sourced from PubChem (CID 87888612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).