About (2S)-2-aminopentanedioic acid;2-(2-hydroxyethylamino)ethanol
(2S)-2-aminopentanedioic acid;2-(2-hydroxyethylamino)ethanol (PubChem CID 87905289) has the molecular formula C9H20N2O6
and a molecular weight of 252.27 g/mol. Its IUPAC name is (2S)-2-aminopentanedioic acid;2-(2-hydroxyethylamino)ethanol.
Molecular Properties
| Compound Name | (2S)-2-aminopentanedioic acid;2-(2-hydroxyethylamino)ethanol |
| PubChem CID | 87905289 |
| Molecular Formula | C9H20N2O6 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | (2S)-2-aminopentanedioic acid;2-(2-hydroxyethylamino)ethanol |
| SMILES | N[C@@H](CCC(=O)O)C(=O)O.OCCNCCO |
| InChI | InChI=1S/C5H9NO4.C4H11NO2/c6-3(5(9)10)1-2-4(7)8;6-3-1-5-2-4-7/h3H,1-2,6H2,(H,7,8)(H,9,10);5-7H,1-4H2/t3-;/m0./s1 |
| InChIKey | HBMXIUZCIHAKCU-DFWYDOINSA-N |
| XLogP | -2.18 |
| TPSA | 153.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-aminopentanedioic acid;2-(2-hydroxyethylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-aminopentanedioic acid;2-(2-hydroxyethylamino)ethanol?
The IUPAC name of (2S)-2-aminopentanedioic acid;2-(2-hydroxyethylamino)ethanol (CID 87905289) is (2S)-2-aminopentanedioic acid;2-(2-hydroxyethylamino)ethanol.
What is the SMILES notation for (2S)-2-aminopentanedioic acid;2-(2-hydroxyethylamino)ethanol?
The canonical SMILES for (2S)-2-aminopentanedioic acid;2-(2-hydroxyethylamino)ethanol is N[C@@H](CCC(=O)O)C(=O)O.OCCNCCO.
What is the InChIKey of (2S)-2-aminopentanedioic acid;2-(2-hydroxyethylamino)ethanol?
The InChIKey is HBMXIUZCIHAKCU-DFWYDOINSA-N. The full InChI is InChI=1S/C5H9NO4.C4H11NO2/c6-3(5(9)10)1-2-4(7)8;6-3-1-5-2-4-7/h3H,1-2,6H2,(H,7,8)(H,9,10);5-7H,1-4H2/t3-;/m0./s1.
What are the key properties of (2S)-2-aminopentanedioic acid;2-(2-hydroxyethylamino)ethanol?
(2S)-2-aminopentanedioic acid;2-(2-hydroxyethylamino)ethanol has a molecular weight of 252.27 g/mol, XLogP of -2.18, 8 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminopentanedioic acid;2-(2-hydroxyethylamino)ethanol is sourced from PubChem (CID 87905289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).