C20H27FN2O5 — CID 87933030
(3S)-3-[[(2S)-2-[[2-[2-(2-fluorophenyl)ethyl]oxan-2-yl]amino]propanoyl]amino]-4-oxobutanoic acid (PubChem CID 87933030) has the molecular formula C20H27FN2O5 and a molecular weight of 394.44 g/mol. Its IUPAC name is (3S)-3-[[(2S)-2-[[2-[2-(2-fluorophenyl)ethyl]oxan-2-yl]amino]propanoyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[(2S)-2-[[2-[2-(2-fluorophenyl)ethyl]oxan-2-yl]amino]propanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 87933030 |
| Molecular Formula | C20H27FN2O5 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | (3S)-3-[[(2S)-2-[[2-[2-(2-fluorophenyl)ethyl]oxan-2-yl]amino]propanoyl]amino]-4-oxobutanoic acid |
| SMILES | C[C@H](NC1(CCc2ccccc2F)CCCCO1)C(=O)N[C@H](C=O)CC(=O)O |
| InChI | InChI=1S/C20H27FN2O5/c1-14(19(27)22-16(13-24)12-18(25)26)23-20(9-4-5-11-28-20)10-8-15-6-2-3-7-17(15)21/h2-3,6-7,13-14,16,23H,4-5,8-12H2,1H3,(H,22,27)(H,25,26)/t14-,16-,20?/m0/s1 |
| InChIKey | DMLLFHXBDZZOFF-UIYGFSLZSA-N |
| XLogP | 1.79 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|