C25H31N3O5 — CID 87933037
(3S)-3-[[(2S)-2-[[2-(N-benzylanilino)oxan-2-yl]amino]propanoyl]amino]-4-oxobutanoic acid (PubChem CID 87933037) has the molecular formula C25H31N3O5 and a molecular weight of 453.54 g/mol. Its IUPAC name is (3S)-3-[[(2S)-2-[[2-(N-benzylanilino)oxan-2-yl]amino]propanoyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[(2S)-2-[[2-(N-benzylanilino)oxan-2-yl]amino]propanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 87933037 |
| Molecular Formula | C25H31N3O5 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | (3S)-3-[[(2S)-2-[[2-(N-benzylanilino)oxan-2-yl]amino]propanoyl]amino]-4-oxobutanoic acid |
| SMILES | C[C@H](NC1(N(Cc2ccccc2)c2ccccc2)CCCCO1)C(=O)N[C@H](C=O)CC(=O)O |
| InChI | InChI=1S/C25H31N3O5/c1-19(24(32)26-21(18-29)16-23(30)31)27-25(14-8-9-15-33-25)28(22-12-6-3-7-13-22)17-20-10-4-2-5-11-20/h2-7,10-13,18-19,21,27H,8-9,14-17H2,1H3,(H,26,32)(H,30,31)/t19-,21-,25?/m0/s1 |
| InChIKey | ROFFHBHQAQXLAI-BODDRMQBSA-N |
| XLogP | 2.68 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|