C16H34N2O5S — CID 87943540
[2,2-dimethyl-3-(2-methylprop-2-enoylamino)propyl]-triethylazanium;methyl sulfate (PubChem CID 87943540) has the molecular formula C16H34N2O5S and a molecular weight of 366.52 g/mol. Its IUPAC name is [2,2-dimethyl-3-(2-methylprop-2-enoylamino)propyl]-triethylazanium;methyl sulfate.
| Compound Name | [2,2-dimethyl-3-(2-methylprop-2-enoylamino)propyl]-triethylazanium;methyl sulfate |
|---|---|
| PubChem CID | 87943540 |
| Molecular Formula | C16H34N2O5S |
| Molecular Weight | 366.52 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | [2,2-dimethyl-3-(2-methylprop-2-enoylamino)propyl]-triethylazanium;methyl sulfate |
| SMILES | C=C(C)C(=O)NCC(C)(C)C[N+](CC)(CC)CC.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C15H30N2O.CH4O4S/c1-8-17(9-2,10-3)12-15(6,7)11-16-14(18)13(4)5;1-5-6(2,3)4/h4,8-12H2,1-3,5-7H3;1H3,(H,2,3,4) |
| InChIKey | ZJRNQGUPSQIFFQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.52 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|