C22H34O6SSi — CID 87956964
[2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-trimethylsilyloxymethyl]cyclohex-2-en-1-yl] 4-methylbenzenesulfonate (PubChem CID 87956964) has the molecular formula C22H34O6SSi and a molecular weight of 454.66 g/mol. Its IUPAC name is [2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-trimethylsilyloxymethyl]cyclohex-2-en-1-yl] 4-methylbenzenesulfonate.
| Compound Name | [2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-trimethylsilyloxymethyl]cyclohex-2-en-1-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87956964 |
| Molecular Formula | C22H34O6SSi |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | [2-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-trimethylsilyloxymethyl]cyclohex-2-en-1-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCCC=C2C(O[Si](C)(C)C)[C@H]2COC(C)(C)O2)cc1 |
| InChI | InChI=1S/C22H34O6SSi/c1-16-11-13-17(14-12-16)29(23,24)27-19-10-8-7-9-18(19)21(28-30(4,5)6)20-15-25-22(2,3)26-20/h9,11-14,19-21H,7-8,10,15H2,1-6H3/t19?,20-,21?/m1/s1 |
| InChIKey | CROGIMKUTSVNMA-NYLDSWQDSA-N |
| XLogP | 4.55 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|