C11H19N3O2S2 — CID 87957120
1-tert-butyl-3-[(2R)-1-hydroxy-3-(1,3-thiazol-5-yl)propan-2-yl]-1-sulfanylurea (PubChem CID 87957120) has the molecular formula C11H19N3O2S2 and a molecular weight of 289.43 g/mol. Its IUPAC name is 1-tert-butyl-3-[(2R)-1-hydroxy-3-(1,3-thiazol-5-yl)propan-2-yl]-1-sulfanylurea.
| Compound Name | 1-tert-butyl-3-[(2R)-1-hydroxy-3-(1,3-thiazol-5-yl)propan-2-yl]-1-sulfanylurea |
|---|---|
| PubChem CID | 87957120 |
| Molecular Formula | C11H19N3O2S2 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 1-tert-butyl-3-[(2R)-1-hydroxy-3-(1,3-thiazol-5-yl)propan-2-yl]-1-sulfanylurea |
| SMILES | CC(C)(C)N(S)C(=O)N[C@@H](CO)Cc1cncs1 |
| InChI | InChI=1S/C11H19N3O2S2/c1-11(2,3)14(17)10(16)13-8(6-15)4-9-5-12-7-18-9/h5,7-8,15,17H,4,6H2,1-3H3,(H,13,16)/t8-/m1/s1 |
| InChIKey | HGXJSCHMDQMFOI-MRVPVSSYSA-N |
| XLogP | 1.70 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|