C30H39N3O4 — CID 87985098
tert-butyl (2S,3S,5R)-2-[amino(phenyl)methyl]-3-hydroxy-5-[5-(4-oxobutyl)-1H-imidazol-2-yl]-6-phenylhexanoate (PubChem CID 87985098) has the molecular formula C30H39N3O4 and a molecular weight of 505.66 g/mol. Its IUPAC name is tert-butyl (2S,3S,5R)-2-[amino(phenyl)methyl]-3-hydroxy-5-[5-(4-oxobutyl)-1H-imidazol-2-yl]-6-phenylhexanoate.
| Compound Name | tert-butyl (2S,3S,5R)-2-[amino(phenyl)methyl]-3-hydroxy-5-[5-(4-oxobutyl)-1H-imidazol-2-yl]-6-phenylhexanoate |
|---|---|
| PubChem CID | 87985098 |
| Molecular Formula | C30H39N3O4 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | tert-butyl (2S,3S,5R)-2-[amino(phenyl)methyl]-3-hydroxy-5-[5-(4-oxobutyl)-1H-imidazol-2-yl]-6-phenylhexanoate |
| SMILES | CC(C)(C)OC(=O)[C@@H](C(N)c1ccccc1)[C@@H](O)C[C@@H](Cc1ccccc1)c1ncc(CCCC=O)[nH]1 |
| InChI | InChI=1S/C30H39N3O4/c1-30(2,3)37-29(36)26(27(31)22-14-8-5-9-15-22)25(35)19-23(18-21-12-6-4-7-13-21)28-32-20-24(33-28)16-10-11-17-34/h4-9,12-15,17,20,23,25-27,35H,10-11,16,18-19,31H2,1-3H3,(H,32,33)/t23-,25+,26-,27?/m1/s1 |
| InChIKey | WPGMDULZVRKSON-PTLRFMENSA-N |
| XLogP | 4.67 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|