C21H30ClNO — CID 87994284
N-(1-bicyclo[3.3.1]nonanylmethyl)-2-chloro-5-prop-2-enylbenzamide;methane (PubChem CID 87994284) has the molecular formula C21H30ClNO and a molecular weight of 347.93 g/mol. Its IUPAC name is N-(1-bicyclo[3.3.1]nonanylmethyl)-2-chloro-5-prop-2-enylbenzamide;methane.
| Compound Name | N-(1-bicyclo[3.3.1]nonanylmethyl)-2-chloro-5-prop-2-enylbenzamide;methane |
|---|---|
| PubChem CID | 87994284 |
| Molecular Formula | C21H30ClNO |
| Molecular Weight | 347.93 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | N-(1-bicyclo[3.3.1]nonanylmethyl)-2-chloro-5-prop-2-enylbenzamide;methane |
| SMILES | C.C=CCc1ccc(Cl)c(C(=O)NCC23CCCC(CCC2)C3)c1 |
| InChI | InChI=1S/C20H26ClNO.CH4/c1-2-5-15-8-9-18(21)17(12-15)19(23)22-14-20-10-3-6-16(13-20)7-4-11-20;/h2,8-9,12,16H,1,3-7,10-11,13-14H2,(H,22,23);1H4 |
| InChIKey | BINBPHDTEJWFKT-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.93 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|