C19H16N3O2+ — CID 8828794
4-(2-isoquinolin-2-ium-2-ylacetyl)-1,3-dihydroquinoxalin-2-one (PubChem CID 8828794) has the molecular formula C19H16N3O2+ and a molecular weight of 318.36 g/mol. Its IUPAC name is 4-(2-isoquinolin-2-ium-2-ylacetyl)-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-(2-isoquinolin-2-ium-2-ylacetyl)-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 8828794 |
| Molecular Formula | C19H16N3O2+ |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 4-(2-isoquinolin-2-ium-2-ylacetyl)-1,3-dihydroquinoxalin-2-one |
| SMILES | O=C1CN(C(=O)C[n+]2ccc3ccccc3c2)c2ccccc2N1 |
| InChI | InChI=1S/C19H15N3O2/c23-18-12-22(17-8-4-3-7-16(17)20-18)19(24)13-21-10-9-14-5-1-2-6-15(14)11-21/h1-11H,12-13H2/p+1 |
| InChIKey | KKVSWBAONCZKHX-UHFFFAOYSA-O |
| XLogP | 2.11 |
| TPSA | 53.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|