C19H17N4O2+ — CID 8855137
4-[2-(3-ethenylbenzimidazol-1-ium-1-yl)acetyl]-1,3-dihydroquinoxalin-2-one (PubChem CID 8855137) has the molecular formula C19H17N4O2+ and a molecular weight of 333.37 g/mol. Its IUPAC name is 4-[2-(3-ethenylbenzimidazol-1-ium-1-yl)acetyl]-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-[2-(3-ethenylbenzimidazol-1-ium-1-yl)acetyl]-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 8855137 |
| Molecular Formula | C19H17N4O2+ |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 4-[2-(3-ethenylbenzimidazol-1-ium-1-yl)acetyl]-1,3-dihydroquinoxalin-2-one |
| SMILES | C=Cn1c[n+](CC(=O)N2CC(=O)Nc3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C19H16N4O2/c1-2-21-13-22(17-10-6-5-9-16(17)21)12-19(25)23-11-18(24)20-14-7-3-4-8-15(14)23/h2-10,13H,1,11-12H2/p+1 |
| InChIKey | RCWOWZAIRVORPZ-UHFFFAOYSA-O |
| XLogP | 2.01 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|