C22H22O5 — CID 8831038
(E)-1-(3-ethyl-5-methyl-1-benzofuran-2-yl)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 8831038) has the molecular formula C22H22O5 and a molecular weight of 366.41 g/mol. Its IUPAC name is (E)-1-(3-ethyl-5-methyl-1-benzofuran-2-yl)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(3-ethyl-5-methyl-1-benzofuran-2-yl)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 8831038 |
| Molecular Formula | C22H22O5 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | (E)-1-(3-ethyl-5-methyl-1-benzofuran-2-yl)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | CCc1c(C(=O)/C=C/c2cc(OC)c(O)c(OC)c2)oc2ccc(C)cc12 |
| InChI | InChI=1S/C22H22O5/c1-5-15-16-10-13(2)6-9-18(16)27-22(15)17(23)8-7-14-11-19(25-3)21(24)20(12-14)26-4/h6-12,24H,5H2,1-4H3/b8-7+ |
| InChIKey | GKJYEYRBYPZCKS-BQYQJAHWSA-N |
| XLogP | 4.92 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|