C28H42IN5O2 — CID 88506800
3-[(6aR,10aR)-5-[(4-methylmorpholin-4-ium-4-yl)methyl]-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea iodide (PubChem CID 88506800) has the molecular formula C28H42IN5O2 and a molecular weight of 607.58 g/mol. Its IUPAC name is 3-[(6aR,10aR)-5-[(4-methylmorpholin-4-ium-4-yl)methyl]-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea iodide.
| Compound Name | 3-[(6aR,10aR)-5-[(4-methylmorpholin-4-ium-4-yl)methyl]-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea iodide |
|---|---|
| PubChem CID | 88506800 |
| Molecular Formula | C28H42IN5O2 |
| Molecular Weight | 607.58 g/mol |
| Exact Mass | 607.24 |
| IUPAC Name | 3-[(6aR,10aR)-5-[(4-methylmorpholin-4-ium-4-yl)methyl]-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea iodide |
| SMILES | C=CCN1CC(NC(=O)N(CC)CC)C[C@@H]2c3cccc4[nH]c(C[N+]5(C)CCOCC5)c(c34)C[C@H]21.[I-] |
| InChI | InChI=1S/C28H41N5O2.HI/c1-5-11-32-18-20(29-28(34)31(6-2)7-3)16-22-21-9-8-10-24-27(21)23(17-26(22)32)25(30-24)19-33(4)12-14-35-15-13-33;/h5,8-10,20,22,26,30H,1,6-7,11-19H2,2-4H3;1H/t20?,22-,26-;/m1./s1 |
| InChIKey | PFXMSDIMNINRDN-LKHYBSONSA-N |
| XLogP | 0.47 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.58 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|