C24H23N3O4 — CID 88511106
(N-(2,7-dimethoxyacridin-1-yl)anilino)methyl N-methylcarbamate (PubChem CID 88511106) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is (N-(2,7-dimethoxyacridin-1-yl)anilino)methyl N-methylcarbamate.
| Compound Name | (N-(2,7-dimethoxyacridin-1-yl)anilino)methyl N-methylcarbamate |
|---|---|
| PubChem CID | 88511106 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | (N-(2,7-dimethoxyacridin-1-yl)anilino)methyl N-methylcarbamate |
| SMILES | CNC(=O)OCN(c1ccccc1)c1c(OC)ccc2nc3ccc(OC)cc3cc12 |
| InChI | InChI=1S/C24H23N3O4/c1-25-24(28)31-15-27(17-7-5-4-6-8-17)23-19-14-16-13-18(29-2)9-10-20(16)26-21(19)11-12-22(23)30-3/h4-14H,15H2,1-3H3,(H,25,28) |
| InChIKey | FKCWJSPQRKICGB-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|