C22H20N2O3 — CID 88511040
(1-anilino-2,7-dimethoxyacridin-3-yl)methanol (PubChem CID 88511040) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is (1-anilino-2,7-dimethoxyacridin-3-yl)methanol.
| Compound Name | (1-anilino-2,7-dimethoxyacridin-3-yl)methanol |
|---|---|
| PubChem CID | 88511040 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | (1-anilino-2,7-dimethoxyacridin-3-yl)methanol |
| SMILES | COc1ccc2nc3cc(CO)c(OC)c(Nc4ccccc4)c3cc2c1 |
| InChI | InChI=1S/C22H20N2O3/c1-26-17-8-9-19-14(10-17)11-18-20(24-19)12-15(13-25)22(27-2)21(18)23-16-6-4-3-5-7-16/h3-12,23,25H,13H2,1-2H3 |
| InChIKey | OXZPESYAQYFLLG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|