C25H25N3O4 — CID 88511074
(N-(2,3-dimethoxy-7-methylacridin-1-yl)anilino)methyl N-methylcarbamate (PubChem CID 88511074) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is (N-(2,3-dimethoxy-7-methylacridin-1-yl)anilino)methyl N-methylcarbamate.
| Compound Name | (N-(2,3-dimethoxy-7-methylacridin-1-yl)anilino)methyl N-methylcarbamate |
|---|---|
| PubChem CID | 88511074 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | (N-(2,3-dimethoxy-7-methylacridin-1-yl)anilino)methyl N-methylcarbamate |
| SMILES | CNC(=O)OCN(c1ccccc1)c1c(OC)c(OC)cc2nc3ccc(C)cc3cc12 |
| InChI | InChI=1S/C25H25N3O4/c1-16-10-11-20-17(12-16)13-19-21(27-20)14-22(30-3)24(31-4)23(19)28(15-32-25(29)26-2)18-8-6-5-7-9-18/h5-14H,15H2,1-4H3,(H,26,29) |
| InChIKey | QJAJKDQMVFJHMH-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|