C21H22N6O8S — CID 88527135
2-[(2S)-5-(1-carboxyprop-2-enyl)-2-[[(2Z)-2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-oxo-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazol-6-yl]but-3-enoic acid (PubChem CID 88527135) has the molecular formula C21H22N6O8S and a molecular weight of 518.51 g/mol. Its IUPAC name is 2-[(2S)-5-(1-carboxyprop-2-enyl)-2-[[(2Z)-2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-oxo-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazol-6-yl]but-3-enoic acid.
| Compound Name | 2-[(2S)-5-(1-carboxyprop-2-enyl)-2-[[(2Z)-2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-oxo-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazol-6-yl]but-3-enoic acid |
|---|---|
| PubChem CID | 88527135 |
| Molecular Formula | C21H22N6O8S |
| Molecular Weight | 518.51 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | 2-[(2S)-5-(1-carboxyprop-2-enyl)-2-[[(2Z)-2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-oxo-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazol-6-yl]but-3-enoic acid |
| SMILES | C=CC(C(=O)O)C1=C(C(C=C)C(=O)O)N2C(=O)[C@@H](NC(=O)/C(=N\OC)c3csc(NC=O)n3)CN2C1 |
| InChI | InChI=1S/C21H22N6O8S/c1-4-10(19(31)32)12-6-26-7-13(18(30)27(26)16(12)11(5-2)20(33)34)23-17(29)15(25-35-3)14-8-36-21(24-14)22-9-28/h4-5,8-11,13H,1-2,6-7H2,3H3,(H,23,29)(H,31,32)(H,33,34)(H,22,24,28)/b25-15-/t10?,11?,13-/m0/s1 |
| InChIKey | JOWDBLXDCYNRCW-PVLKDVHTSA-N |
| XLogP | -0.35 |
| TPSA | 190.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.51 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|