C11H13F9 — CID 88590926
1,1,1,2,6,7,7,7-octafluoro-4-(1-fluoroethenyl)-2,6-dimethylheptane (PubChem CID 88590926) has the molecular formula C11H13F9 and a molecular weight of 316.21 g/mol. Its IUPAC name is 1,1,1,2,6,7,7,7-octafluoro-4-(1-fluoroethenyl)-2,6-dimethylheptane.
| Compound Name | 1,1,1,2,6,7,7,7-octafluoro-4-(1-fluoroethenyl)-2,6-dimethylheptane |
|---|---|
| PubChem CID | 88590926 |
| Molecular Formula | C11H13F9 |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 1,1,1,2,6,7,7,7-octafluoro-4-(1-fluoroethenyl)-2,6-dimethylheptane |
| SMILES | C=C(F)C(CC(C)(F)C(F)(F)F)CC(C)(F)C(F)(F)F |
| InChI | InChI=1S/C11H13F9/c1-6(12)7(4-8(2,13)10(15,16)17)5-9(3,14)11(18,19)20/h7H,1,4-5H2,2-3H3 |
| InChIKey | PFLZAPNTBIFPJI-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |