C21H26O7 — CID 88591831
2-[2-(7-hydroxy-2-oxochromen-4-yl)acetyl]oxyethyl 2-ethyl-2-methylpentanoate (PubChem CID 88591831) has the molecular formula C21H26O7 and a molecular weight of 390.43 g/mol. Its IUPAC name is 2-[2-(7-hydroxy-2-oxochromen-4-yl)acetyl]oxyethyl 2-ethyl-2-methylpentanoate.
| Compound Name | 2-[2-(7-hydroxy-2-oxochromen-4-yl)acetyl]oxyethyl 2-ethyl-2-methylpentanoate |
|---|---|
| PubChem CID | 88591831 |
| Molecular Formula | C21H26O7 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 2-[2-(7-hydroxy-2-oxochromen-4-yl)acetyl]oxyethyl 2-ethyl-2-methylpentanoate |
| SMILES | CCCC(C)(CC)C(=O)OCCOC(=O)Cc1cc(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C21H26O7/c1-4-8-21(3,5-2)20(25)27-10-9-26-18(23)11-14-12-19(24)28-17-13-15(22)6-7-16(14)17/h6-7,12-13,22H,4-5,8-11H2,1-3H3 |
| InChIKey | QWOQWYRTJJNWDO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|