C29H40O5 — CID 88604037
(1'S,2'S,3'S,5'S,6'S,7'S,9'R,16'R)-9'-ethenyl-6'-(3-hydroxyprop-1-ynyl)-5,5,7'-trimethylspiro[dioxane-3,14'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-10-ene]-6',16'-diol (PubChem CID 88604037) has the molecular formula C29H40O5 and a molecular weight of 468.63 g/mol. Its IUPAC name is (1'S,2'S,3'S,5'S,6'S,7'S,9'R,16'R)-9'-ethenyl-6'-(3-hydroxyprop-1-ynyl)-5,5,7'-trimethylspiro[dioxane-3,14'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-10-ene]-6',16'-diol.
| Compound Name | (1'S,2'S,3'S,5'S,6'S,7'S,9'R,16'R)-9'-ethenyl-6'-(3-hydroxyprop-1-ynyl)-5,5,7'-trimethylspiro[dioxane-3,14'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-10-ene]-6',16'-diol |
|---|---|
| PubChem CID | 88604037 |
| Molecular Formula | C29H40O5 |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | (1'S,2'S,3'S,5'S,6'S,7'S,9'R,16'R)-9'-ethenyl-6'-(3-hydroxyprop-1-ynyl)-5,5,7'-trimethylspiro[dioxane-3,14'-pentacyclo[8.8.0.02,7.03,5.011,16]octadec-10-ene]-6',16'-diol |
| SMILES | C=C[C@H]1C[C@@]2(C)[C@@H]([C@@H]3C[C@@H]3[C@@]2(O)C#CCO)[C@@H]2CC[C@@]3(O)CC4(CCC3=C21)CC(C)(C)COO4 |
| InChI | InChI=1S/C29H40O5/c1-5-18-14-26(4)24(20-13-22(20)29(26,32)9-6-12-30)19-7-11-28(31)16-27(10-8-21(28)23(18)19)15-25(2,3)17-33-34-27/h5,18-20,22,24,30-32H,1,7-8,10-17H2,2-4H3/t18-,19+,20+,22-,24+,26-,27?,28+,29-/m0/s1 |
| InChIKey | RLYSEYURLCFXQU-JECVYVHSSA-N |
| XLogP | 3.93 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|