C15H14ClF17NaO5P — CID 88619740
sodium (3-chloro-2-hydroxypropyl) 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9-heptadecafluorododecyl phosphate (PubChem CID 88619740) has the molecular formula C15H14ClF17NaO5P and a molecular weight of 686.65 g/mol. Its IUPAC name is sodium (3-chloro-2-hydroxypropyl) 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9-heptadecafluorododecyl phosphate.
| Compound Name | sodium (3-chloro-2-hydroxypropyl) 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9-heptadecafluorododecyl phosphate |
|---|---|
| PubChem CID | 88619740 |
| Molecular Formula | C15H14ClF17NaO5P |
| Molecular Weight | 686.65 g/mol |
| Exact Mass | 685.99 |
| IUPAC Name | sodium (3-chloro-2-hydroxypropyl) 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9-heptadecafluorododecyl phosphate |
| SMILES | CCCC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)OP(=O)([O-])OCC(O)CCl.[Na+] |
| InChI | InChI=1S/C15H15ClF17O5P.Na/c1-2-3-7(17)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)13(28,29)14(30,31)15(32,33)38-39(35,36)37-5-6(34)4-16;/h6-7,34H,2-5H2,1H3,(H,35,36);/q;+1/p-1 |
| InChIKey | RGCLOEPJKIIWPU-UHFFFAOYSA-M |
| XLogP | 3.27 |
| TPSA | 78.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.65 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|