C21H35NO4 — CID 88627032
2-[[3,5-ditert-butyl-4-hydroxy-2-(hydroxyamino)phenyl]methyl]-2-ethylbutanoic acid (PubChem CID 88627032) has the molecular formula C21H35NO4 and a molecular weight of 365.51 g/mol. Its IUPAC name is 2-[[3,5-ditert-butyl-4-hydroxy-2-(hydroxyamino)phenyl]methyl]-2-ethylbutanoic acid.
| Compound Name | 2-[[3,5-ditert-butyl-4-hydroxy-2-(hydroxyamino)phenyl]methyl]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 88627032 |
| Molecular Formula | C21H35NO4 |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | 2-[[3,5-ditert-butyl-4-hydroxy-2-(hydroxyamino)phenyl]methyl]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1NO)C(=O)O |
| InChI | InChI=1S/C21H35NO4/c1-9-21(10-2,18(24)25)12-13-11-14(19(3,4)5)17(23)15(16(13)22-26)20(6,7)8/h11,22-23,26H,9-10,12H2,1-8H3,(H,24,25) |
| InChIKey | JMCKFGUJGBUKRY-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|