About sodium 2-propylperoxyacetate
sodium 2-propylperoxyacetate (PubChem CID 88670318) has the molecular formula C5H9NaO4
and a molecular weight of 156.11 g/mol. Its IUPAC name is sodium 2-propylperoxyacetate.
Molecular Properties
| Compound Name | sodium 2-propylperoxyacetate |
| PubChem CID | 88670318 |
| Molecular Formula | C5H9NaO4 |
| Molecular Weight | 156.11 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | sodium 2-propylperoxyacetate |
| SMILES | CCCOOCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C5H10O4.Na/c1-2-3-8-9-4-5(6)7;/h2-4H2,1H3,(H,6,7);/q;+1/p-1 |
| InChIKey | MAPXOEBROYQADM-UHFFFAOYSA-M |
| XLogP | -3.90 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.11 |
| LogP ≤ 5 | -3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-propylperoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-propylperoxyacetate?
The IUPAC name of sodium 2-propylperoxyacetate (CID 88670318) is sodium 2-propylperoxyacetate.
What is the SMILES notation for sodium 2-propylperoxyacetate?
The canonical SMILES for sodium 2-propylperoxyacetate is CCCOOCC(=O)[O-].[Na+].
What is the InChIKey of sodium 2-propylperoxyacetate?
The InChIKey is MAPXOEBROYQADM-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H10O4.Na/c1-2-3-8-9-4-5(6)7;/h2-4H2,1H3,(H,6,7);/q;+1/p-1.
What are the key properties of sodium 2-propylperoxyacetate?
sodium 2-propylperoxyacetate has a molecular weight of 156.11 g/mol, XLogP of -3.90, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-propylperoxyacetate is sourced from PubChem (CID 88670318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).