sodium 2-propylperoxyacetate

C5H9NaO4 — CID 88670318

IUPACsodium 2-propylperoxyacetate
SMILESCCCOOCC(=O)[O-].[Na+]
InChIInChI=1S/C5H10O4.Na/c1-2-3-8-9-4-5(6)7;/h2-4H2,1H3,(H,6,7);/q;+1/p-1
InChIKeyMAPXOEBROYQADM-UHFFFAOYSA-M
MW156.11 g/mol
LogP-3.90
Rot. Bonds5

About sodium 2-propylperoxyacetate

sodium 2-propylperoxyacetate (PubChem CID 88670318) has the molecular formula C5H9NaO4 and a molecular weight of 156.11 g/mol. Its IUPAC name is sodium 2-propylperoxyacetate.

Molecular Properties

Compound Namesodium 2-propylperoxyacetate
PubChem CID88670318
Molecular FormulaC5H9NaO4
Molecular Weight156.11 g/mol
Exact Mass156.04
IUPAC Namesodium 2-propylperoxyacetate
SMILESCCCOOCC(=O)[O-].[Na+]
InChIInChI=1S/C5H10O4.Na/c1-2-3-8-9-4-5(6)7;/h2-4H2,1H3,(H,6,7);/q;+1/p-1
InChIKeyMAPXOEBROYQADM-UHFFFAOYSA-M
XLogP-3.90
TPSA58.59 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.11
LogP ≤ 5-3.90
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}

Analyze sodium 2-propylperoxyacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 2-propylperoxyacetate?
The IUPAC name of sodium 2-propylperoxyacetate (CID 88670318) is sodium 2-propylperoxyacetate.
What is the SMILES notation for sodium 2-propylperoxyacetate?
The canonical SMILES for sodium 2-propylperoxyacetate is CCCOOCC(=O)[O-].[Na+].
What is the InChIKey of sodium 2-propylperoxyacetate?
The InChIKey is MAPXOEBROYQADM-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H10O4.Na/c1-2-3-8-9-4-5(6)7;/h2-4H2,1H3,(H,6,7);/q;+1/p-1.
What are the key properties of sodium 2-propylperoxyacetate?
sodium 2-propylperoxyacetate has a molecular weight of 156.11 g/mol, XLogP of -3.90, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-propylperoxyacetate is sourced from PubChem (CID 88670318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).