C22H14O14 — CID 88688423
4-(2,4-dicarboxybenzoyl)oxycarbonylbenzene-1,3-dicarboxylic acid;oxolane-2,5-dione (PubChem CID 88688423) has the molecular formula C22H14O14 and a molecular weight of 502.34 g/mol. Its IUPAC name is 4-(2,4-dicarboxybenzoyl)oxycarbonylbenzene-1,3-dicarboxylic acid;oxolane-2,5-dione.
| Compound Name | 4-(2,4-dicarboxybenzoyl)oxycarbonylbenzene-1,3-dicarboxylic acid;oxolane-2,5-dione |
|---|---|
| PubChem CID | 88688423 |
| Molecular Formula | C22H14O14 |
| Molecular Weight | 502.34 g/mol |
| Exact Mass | 502.04 |
| IUPAC Name | 4-(2,4-dicarboxybenzoyl)oxycarbonylbenzene-1,3-dicarboxylic acid;oxolane-2,5-dione |
| SMILES | O=C(O)c1ccc(C(=O)OC(=O)c2ccc(C(=O)O)cc2C(=O)O)c(C(=O)O)c1.O=C1CCC(=O)O1 |
| InChI | InChI=1S/C18H10O11.C4H4O3/c19-13(20)7-1-3-9(11(5-7)15(23)24)17(27)29-18(28)10-4-2-8(14(21)22)6-12(10)16(25)26;5-3-1-2-4(6)7-3/h1-6H,(H,19,20)(H,21,22)(H,23,24)(H,25,26);1-2H2 |
| InChIKey | QPUAGIFBGUGECZ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 235.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.34 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|