C23H28N2O5S3 — CID 88696856
benzyl (2S,5R,6S)-2-amino-3,3,6-trimethyl-7-sulfanylidene-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate;4-methylbenzenesulfonic acid (PubChem CID 88696856) has the molecular formula C23H28N2O5S3 and a molecular weight of 508.69 g/mol. Its IUPAC name is benzyl (2S,5R,6S)-2-amino-3,3,6-trimethyl-7-sulfanylidene-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate;4-methylbenzenesulfonic acid.
| Compound Name | benzyl (2S,5R,6S)-2-amino-3,3,6-trimethyl-7-sulfanylidene-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 88696856 |
| Molecular Formula | C23H28N2O5S3 |
| Molecular Weight | 508.69 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | benzyl (2S,5R,6S)-2-amino-3,3,6-trimethyl-7-sulfanylidene-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate;4-methylbenzenesulfonic acid |
| SMILES | C[C@@H]1C(=S)N2[C@@H]1SC(C)(C)[C@]2(N)C(=O)OCc1ccccc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C16H20N2O2S2.C7H8O3S/c1-10-12(21)18-13(10)22-15(2,3)16(18,17)14(19)20-9-11-7-5-4-6-8-11;1-6-2-4-7(5-3-6)11(8,9)10/h4-8,10,13H,9,17H2,1-3H3;2-5H,1H3,(H,8,9,10)/t10-,13-,16+;/m1./s1 |
| InChIKey | DZLNARJPAQMYJX-XWIJZFJFSA-N |
| XLogP | 3.76 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.69 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|