C8H5N7O6 — CID 88747650
5-(2,4,6-trinitrophenyl)-1H-1,2,4-triazol-3-amine (PubChem CID 88747650) has the molecular formula C8H5N7O6 and a molecular weight of 295.17 g/mol. Its IUPAC name is 5-(2,4,6-trinitrophenyl)-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-(2,4,6-trinitrophenyl)-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 88747650 |
| Molecular Formula | C8H5N7O6 |
| Molecular Weight | 295.17 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 5-(2,4,6-trinitrophenyl)-1H-1,2,4-triazol-3-amine |
| SMILES | Nc1n[nH]c(-c2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C8H5N7O6/c9-8-10-7(11-12-8)6-4(14(18)19)1-3(13(16)17)2-5(6)15(20)21/h1-2H,(H3,9,10,11,12) |
| InChIKey | CCZULCNLMSCYJX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 197.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.17 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|