C18H22I3N3O8 — CID 88756726
N-[3-[(3S,4R,5S,6R)-3-acetamido-4,5,6,7-tetrahydroxy-3-(methylamino)-2-oxoheptanoyl]-2,4,6-triiodophenyl]acetamide (PubChem CID 88756726) has the molecular formula C18H22I3N3O8 and a molecular weight of 789.10 g/mol. Its IUPAC name is N-[3-[(3S,4R,5S,6R)-3-acetamido-4,5,6,7-tetrahydroxy-3-(methylamino)-2-oxoheptanoyl]-2,4,6-triiodophenyl]acetamide.
| Compound Name | N-[3-[(3S,4R,5S,6R)-3-acetamido-4,5,6,7-tetrahydroxy-3-(methylamino)-2-oxoheptanoyl]-2,4,6-triiodophenyl]acetamide |
|---|---|
| PubChem CID | 88756726 |
| Molecular Formula | C18H22I3N3O8 |
| Molecular Weight | 789.10 g/mol |
| Exact Mass | 788.85 |
| IUPAC Name | N-[3-[(3S,4R,5S,6R)-3-acetamido-4,5,6,7-tetrahydroxy-3-(methylamino)-2-oxoheptanoyl]-2,4,6-triiodophenyl]acetamide |
| SMILES | CN[C@@](NC(C)=O)(C(=O)C(=O)c1c(I)cc(I)c(NC(C)=O)c1I)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C18H22I3N3O8/c1-6(26)23-13-9(20)4-8(19)11(12(13)21)15(30)17(32)18(22-3,24-7(2)27)16(31)14(29)10(28)5-25/h4,10,14,16,22,25,28-29,31H,5H2,1-3H3,(H,23,26)(H,24,27)/t10-,14-,16+,18+/m1/s1 |
| InChIKey | IQUORYXMVJCBSQ-GACZVYGISA-N |
| XLogP | -0.66 |
| TPSA | 185.29 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.10 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|