About diethyl(hexyl)stannanylium;2-sulfanylpropanoate
diethyl(hexyl)stannanylium;2-sulfanylpropanoate (PubChem CID 88760346) has the molecular formula C13H28O2SSn
and a molecular weight of 367.14 g/mol. Its IUPAC name is diethyl(hexyl)stannanylium;2-sulfanylpropanoate.
Molecular Properties
| Compound Name | diethyl(hexyl)stannanylium;2-sulfanylpropanoate |
| PubChem CID | 88760346 |
| Molecular Formula | C13H28O2SSn |
| Molecular Weight | 367.14 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | diethyl(hexyl)stannanylium;2-sulfanylpropanoate |
| SMILES | CC(S)C(=O)[O-].CCCCCC[Sn+](CC)CC |
| InChI | InChI=1S/C6H13.C3H6O2S.2C2H5.Sn/c1-3-5-6-4-2;1-2(6)3(4)5;2*1-2;/h1,3-6H2,2H3;2,6H,1H3,(H,4,5);2*1H2,2H3;/q;;;;+1/p-1 |
| InChIKey | VJCYQILTEBZRFG-UHFFFAOYSA-M |
| XLogP | 3.16 |
| TPSA | 40.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.14 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze diethyl(hexyl)stannanylium;2-sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl(hexyl)stannanylium;2-sulfanylpropanoate?
The IUPAC name of diethyl(hexyl)stannanylium;2-sulfanylpropanoate (CID 88760346) is diethyl(hexyl)stannanylium;2-sulfanylpropanoate.
What is the SMILES notation for diethyl(hexyl)stannanylium;2-sulfanylpropanoate?
The canonical SMILES for diethyl(hexyl)stannanylium;2-sulfanylpropanoate is CC(S)C(=O)[O-].CCCCCC[Sn+](CC)CC.
What is the InChIKey of diethyl(hexyl)stannanylium;2-sulfanylpropanoate?
The InChIKey is VJCYQILTEBZRFG-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H13.C3H6O2S.2C2H5.Sn/c1-3-5-6-4-2;1-2(6)3(4)5;2*1-2;/h1,3-6H2,2H3;2,6H,1H3,(H,4,5);2*1H2,2H3;/q;;;;+1/p-1.
What are the key properties of diethyl(hexyl)stannanylium;2-sulfanylpropanoate?
diethyl(hexyl)stannanylium;2-sulfanylpropanoate has a molecular weight of 367.14 g/mol, XLogP of 3.16, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl(hexyl)stannanylium;2-sulfanylpropanoate is sourced from PubChem (CID 88760346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).