C15H17BrN4O2 — CID 88784923
ethyl 2-[4-(1H-triazolo[1,5-a]pyridin-2-yl)pyridin-1-ium-1-yl]acetate bromide (PubChem CID 88784923) has the molecular formula C15H17BrN4O2 and a molecular weight of 365.23 g/mol. Its IUPAC name is ethyl 2-[4-(1H-triazolo[1,5-a]pyridin-2-yl)pyridin-1-ium-1-yl]acetate bromide.
| Compound Name | ethyl 2-[4-(1H-triazolo[1,5-a]pyridin-2-yl)pyridin-1-ium-1-yl]acetate bromide |
|---|---|
| PubChem CID | 88784923 |
| Molecular Formula | C15H17BrN4O2 |
| Molecular Weight | 365.23 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | ethyl 2-[4-(1H-triazolo[1,5-a]pyridin-2-yl)pyridin-1-ium-1-yl]acetate bromide |
| SMILES | CCOC(=O)C[n+]1ccc(N2C=C3C=CC=CN3N2)cc1.[Br-] |
| InChI | InChI=1S/C15H17N4O2.BrH/c1-2-21-15(20)12-17-9-6-13(7-10-17)19-11-14-5-3-4-8-18(14)16-19;/h3-11,16H,2,12H2,1H3;1H/q+1;/p-1 |
| InChIKey | DRRBKTRGLWZJDX-UHFFFAOYSA-M |
| XLogP | -1.99 |
| TPSA | 48.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.23 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|