C23H29ClN2O8 — CID 88794619
methyl (Z)-3-[(1S)-1-ethyl-9-methoxy-2,3,4,6,7,12-hexahydroindolo[2,3-a]quinolizin-5-ium-1-yl]-2-methoxyprop-2-enoate perchlorate (PubChem CID 88794619) has the molecular formula C23H29ClN2O8 and a molecular weight of 496.94 g/mol. Its IUPAC name is methyl (Z)-3-[(1S)-1-ethyl-9-methoxy-2,3,4,6,7,12-hexahydroindolo[2,3-a]quinolizin-5-ium-1-yl]-2-methoxyprop-2-enoate perchlorate.
| Compound Name | methyl (Z)-3-[(1S)-1-ethyl-9-methoxy-2,3,4,6,7,12-hexahydroindolo[2,3-a]quinolizin-5-ium-1-yl]-2-methoxyprop-2-enoate perchlorate |
|---|---|
| PubChem CID | 88794619 |
| Molecular Formula | C23H29ClN2O8 |
| Molecular Weight | 496.94 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | methyl (Z)-3-[(1S)-1-ethyl-9-methoxy-2,3,4,6,7,12-hexahydroindolo[2,3-a]quinolizin-5-ium-1-yl]-2-methoxyprop-2-enoate perchlorate |
| SMILES | CC[C@@]1(/C=C(\OC)C(=O)OC)CCC[N+]2=C1c1[nH]c3ccc(OC)cc3c1CC2.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C23H28N2O4.ClHO4/c1-5-23(14-19(28-3)22(26)29-4)10-6-11-25-12-9-16-17-13-15(27-2)7-8-18(17)24-20(16)21(23)25;2-1(3,4)5/h7-8,13-14H,5-6,9-12H2,1-4H3;(H,2,3,4,5)/b19-14-;/t23-;/m0./s1 |
| InChIKey | CLIZJLGCILXWII-ZXGXVZMWSA-N |
| XLogP | -1.33 |
| TPSA | 155.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.94 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|