C8H6Cl4N2 — CID 88827459
3,5-dichloro-N-(dichloromethylideneamino)-2-methylaniline (PubChem CID 88827459) has the molecular formula C8H6Cl4N2 and a molecular weight of 271.96 g/mol. Its IUPAC name is 3,5-dichloro-N-(dichloromethylideneamino)-2-methylaniline.
| Compound Name | 3,5-dichloro-N-(dichloromethylideneamino)-2-methylaniline |
|---|---|
| PubChem CID | 88827459 |
| Molecular Formula | C8H6Cl4N2 |
| Molecular Weight | 271.96 g/mol |
| Exact Mass | 269.93 |
| IUPAC Name | 3,5-dichloro-N-(dichloromethylideneamino)-2-methylaniline |
| SMILES | Cc1c(Cl)cc(Cl)cc1NN=C(Cl)Cl |
| InChI | InChI=1S/C8H6Cl4N2/c1-4-6(10)2-5(9)3-7(4)13-14-8(11)12/h2-3,13H,1H3 |
| InChIKey | KVMZBWKBRWVNBS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.96 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|