C20H19ClN4O5 — CID 88838053
[[(1R)-1-(4-nitrophenyl)ethyl]amino] (2S)-3-(6-chloro-1H-indol-3-yl)-2-formamidopropanoate (PubChem CID 88838053) has the molecular formula C20H19ClN4O5 and a molecular weight of 430.85 g/mol. Its IUPAC name is [[(1R)-1-(4-nitrophenyl)ethyl]amino] (2S)-3-(6-chloro-1H-indol-3-yl)-2-formamidopropanoate.
| Compound Name | [[(1R)-1-(4-nitrophenyl)ethyl]amino] (2S)-3-(6-chloro-1H-indol-3-yl)-2-formamidopropanoate |
|---|---|
| PubChem CID | 88838053 |
| Molecular Formula | C20H19ClN4O5 |
| Molecular Weight | 430.85 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | [[(1R)-1-(4-nitrophenyl)ethyl]amino] (2S)-3-(6-chloro-1H-indol-3-yl)-2-formamidopropanoate |
| SMILES | C[C@@H](NOC(=O)[C@H](Cc1c[nH]c2cc(Cl)ccc12)NC=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H19ClN4O5/c1-12(13-2-5-16(6-3-13)25(28)29)24-30-20(27)19(23-11-26)8-14-10-22-18-9-15(21)4-7-17(14)18/h2-7,9-12,19,22,24H,8H2,1H3,(H,23,26)/t12-,19+/m1/s1 |
| InChIKey | YWNZPTKPJNKBTO-BLVKFPJESA-N |
| XLogP | 3.20 |
| TPSA | 126.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.85 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|