C22H24N2O3 — CID 88907107
(2E,4E,6E)-2-cyano-7-[2-(4-oxobutyl)-4-pyrrolidin-1-ylphenyl]hepta-2,4,6-trienoic acid (PubChem CID 88907107) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is (2E,4E,6E)-2-cyano-7-[2-(4-oxobutyl)-4-pyrrolidin-1-ylphenyl]hepta-2,4,6-trienoic acid.
| Compound Name | (2E,4E,6E)-2-cyano-7-[2-(4-oxobutyl)-4-pyrrolidin-1-ylphenyl]hepta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 88907107 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (2E,4E,6E)-2-cyano-7-[2-(4-oxobutyl)-4-pyrrolidin-1-ylphenyl]hepta-2,4,6-trienoic acid |
| SMILES | N#C/C(=C\C=C\C=C\c1ccc(N2CCCC2)cc1CCCC=O)C(=O)O |
| InChI | InChI=1S/C22H24N2O3/c23-17-20(22(26)27)10-3-1-2-8-18-11-12-21(24-13-5-6-14-24)16-19(18)9-4-7-15-25/h1-3,8,10-12,15-16H,4-7,9,13-14H2,(H,26,27)/b3-1+,8-2+,20-10+ |
| InChIKey | YLGCXFFDHKKEBP-KRRATQMJSA-N |
| XLogP | 3.91 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|